About 1H-indole;tributyl(ethyl)phosphanium
1H-indole;tributyl(ethyl)phosphanium (PubChem CID 158484132) has the molecular formula C22H39NP+
and a molecular weight of 348.54 g/mol. Its IUPAC name is 1H-indole;tributyl(ethyl)phosphanium.
Molecular Properties
| Compound Name | 1H-indole;tributyl(ethyl)phosphanium |
| PubChem CID | 158484132 |
| Molecular Formula | C22H39NP+ |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 1H-indole;tributyl(ethyl)phosphanium |
| SMILES | CCCC[P+](CC)(CCCC)CCCC.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H32P.C8H7N/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;1-2-4-8-7(3-1)5-6-9-8/h5-14H2,1-4H3;1-6,9H/q+1; |
| InChIKey | CYTKEWROSKZPJA-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole;tributyl(ethyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;tributyl(ethyl)phosphanium?
The IUPAC name of 1H-indole;tributyl(ethyl)phosphanium (CID 158484132) is 1H-indole;tributyl(ethyl)phosphanium.
What is the SMILES notation for 1H-indole;tributyl(ethyl)phosphanium?
The canonical SMILES for 1H-indole;tributyl(ethyl)phosphanium is CCCC[P+](CC)(CCCC)CCCC.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;tributyl(ethyl)phosphanium?
The InChIKey is CYTKEWROSKZPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32P.C8H7N/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;1-2-4-8-7(3-1)5-6-9-8/h5-14H2,1-4H3;1-6,9H/q+1;.
What are the key properties of 1H-indole;tributyl(ethyl)phosphanium?
1H-indole;tributyl(ethyl)phosphanium has a molecular weight of 348.54 g/mol, XLogP of 7.59, 10 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;tributyl(ethyl)phosphanium is sourced from PubChem (CID 158484132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).