About butanoic acid;1H-indole;propanoic acid
butanoic acid;1H-indole;propanoic acid (PubChem CID 135353070) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is butanoic acid;1H-indole;propanoic acid.
Molecular Properties
| Compound Name | butanoic acid;1H-indole;propanoic acid |
| PubChem CID | 135353070 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | butanoic acid;1H-indole;propanoic acid |
| SMILES | CCC(=O)O.CCCC(=O)O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C4H8O2.C3H6O2/c1-2-4-8-7(3-1)5-6-9-8;1-2-3-4(5)6;1-2-3(4)5/h1-6,9H;2-3H2,1H3,(H,5,6);2H2,1H3,(H,4,5) |
| InChIKey | SZANGMXXCWTQPQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanoic acid;1H-indole;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;1H-indole;propanoic acid?
The IUPAC name of butanoic acid;1H-indole;propanoic acid (CID 135353070) is butanoic acid;1H-indole;propanoic acid.
What is the SMILES notation for butanoic acid;1H-indole;propanoic acid?
The canonical SMILES for butanoic acid;1H-indole;propanoic acid is CCC(=O)O.CCCC(=O)O.c1ccc2[nH]ccc2c1.
What is the InChIKey of butanoic acid;1H-indole;propanoic acid?
The InChIKey is SZANGMXXCWTQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C4H8O2.C3H6O2/c1-2-4-8-7(3-1)5-6-9-8;1-2-3-4(5)6;1-2-3(4)5/h1-6,9H;2-3H2,1H3,(H,5,6);2H2,1H3,(H,4,5).
What are the key properties of butanoic acid;1H-indole;propanoic acid?
butanoic acid;1H-indole;propanoic acid has a molecular weight of 279.34 g/mol, XLogP of 3.52, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;1H-indole;propanoic acid is sourced from PubChem (CID 135353070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).