About 1H-indole;2-naphthalen-1-ylacetic acid
1H-indole;2-naphthalen-1-ylacetic acid (PubChem CID 164968711) has the molecular formula C20H17NO2
and a molecular weight of 303.36 g/mol. Its IUPAC name is 1H-indole;2-naphthalen-1-ylacetic acid.
Molecular Properties
| Compound Name | 1H-indole;2-naphthalen-1-ylacetic acid |
| PubChem CID | 164968711 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1H-indole;2-naphthalen-1-ylacetic acid |
| SMILES | O=C(O)Cc1cccc2ccccc12.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C12H10O2.C8H7N/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;1-2-4-8-7(3-1)5-6-9-8/h1-7H,8H2,(H,13,14);1-6,9H |
| InChIKey | CVDCNHHDZSDLKJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole;2-naphthalen-1-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;2-naphthalen-1-ylacetic acid?
The IUPAC name of 1H-indole;2-naphthalen-1-ylacetic acid (CID 164968711) is 1H-indole;2-naphthalen-1-ylacetic acid.
What is the SMILES notation for 1H-indole;2-naphthalen-1-ylacetic acid?
The canonical SMILES for 1H-indole;2-naphthalen-1-ylacetic acid is O=C(O)Cc1cccc2ccccc12.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;2-naphthalen-1-ylacetic acid?
The InChIKey is CVDCNHHDZSDLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C8H7N/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;1-2-4-8-7(3-1)5-6-9-8/h1-7H,8H2,(H,13,14);1-6,9H.
What are the key properties of 1H-indole;2-naphthalen-1-ylacetic acid?
1H-indole;2-naphthalen-1-ylacetic acid has a molecular weight of 303.36 g/mol, XLogP of 4.63, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;2-naphthalen-1-ylacetic acid is sourced from PubChem (CID 164968711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).