About potassium;2-naphthalen-1-ylacetic acid;hydroxide
potassium;2-naphthalen-1-ylacetic acid;hydroxide (PubChem CID 174974988) has the molecular formula C12H11KO3
and a molecular weight of 242.31 g/mol. Its IUPAC name is potassium;2-naphthalen-1-ylacetic acid;hydroxide.
Molecular Properties
| Compound Name | potassium;2-naphthalen-1-ylacetic acid;hydroxide |
| PubChem CID | 174974988 |
| Molecular Formula | C12H11KO3 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | potassium;2-naphthalen-1-ylacetic acid;hydroxide |
| SMILES | O=C(O)Cc1cccc2ccccc12.[K+].[OH-] |
| InChI | InChI=1S/C12H10O2.K.H2O/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;;/h1-7H,8H2,(H,13,14);;1H2/q;+1;/p-1 |
| InChIKey | WVNZLGNRTLKDDY-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 67.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;2-naphthalen-1-ylacetic acid;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-naphthalen-1-ylacetic acid;hydroxide?
The IUPAC name of potassium;2-naphthalen-1-ylacetic acid;hydroxide (CID 174974988) is potassium;2-naphthalen-1-ylacetic acid;hydroxide.
What is the SMILES notation for potassium;2-naphthalen-1-ylacetic acid;hydroxide?
The canonical SMILES for potassium;2-naphthalen-1-ylacetic acid;hydroxide is O=C(O)Cc1cccc2ccccc12.[K+].[OH-].
What is the InChIKey of potassium;2-naphthalen-1-ylacetic acid;hydroxide?
The InChIKey is WVNZLGNRTLKDDY-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O2.K.H2O/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;;/h1-7H,8H2,(H,13,14);;1H2/q;+1;/p-1.
What are the key properties of potassium;2-naphthalen-1-ylacetic acid;hydroxide?
potassium;2-naphthalen-1-ylacetic acid;hydroxide has a molecular weight of 242.31 g/mol, XLogP of -0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-naphthalen-1-ylacetic acid;hydroxide is sourced from PubChem (CID 174974988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).