C12H7F3N4O6S2 — CID 118391607
[[cyano-[4-(C-cyano-N-methylsulfonyloxycarbonimidoyl)phenyl]methylidene]amino] trifluoromethanesulfonate (PubChem CID 118391607) has the molecular formula C12H7F3N4O6S2 and a molecular weight of 424.34 g/mol. Its IUPAC name is [[cyano-[4-(C-cyano-N-methylsulfonyloxycarbonimidoyl)phenyl]methylidene]amino] trifluoromethanesulfonate.
| Compound Name | [[cyano-[4-(C-cyano-N-methylsulfonyloxycarbonimidoyl)phenyl]methylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118391607 |
| Molecular Formula | C12H7F3N4O6S2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | [[cyano-[4-(C-cyano-N-methylsulfonyloxycarbonimidoyl)phenyl]methylidene]amino] trifluoromethanesulfonate |
| SMILES | CS(=O)(=O)ON=C(C#N)c1ccc(C(C#N)=NOS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H7F3N4O6S2/c1-26(20,21)24-18-10(6-16)8-2-4-9(5-3-8)11(7-17)19-25-27(22,23)12(13,14)15/h2-5H,1H3 |
| InChIKey | QFBICZZOUUWJCD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 159.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|