C12H4F6N4O6S2 — CID 15404180
[(Z)-[cyano-[3-[(Z)-C-cyano-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenyl]methylidene]amino] trifluoromethanesulfonate (PubChem CID 15404180) has the molecular formula C12H4F6N4O6S2 and a molecular weight of 478.31 g/mol. Its IUPAC name is [(Z)-[cyano-[3-[(Z)-C-cyano-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenyl]methylidene]amino] trifluoromethanesulfonate.
| Compound Name | [(Z)-[cyano-[3-[(Z)-C-cyano-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenyl]methylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15404180 |
| Molecular Formula | C12H4F6N4O6S2 |
| Molecular Weight | 478.31 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | [(Z)-[cyano-[3-[(Z)-C-cyano-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenyl]methylidene]amino] trifluoromethanesulfonate |
| SMILES | N#C/C(=N\OS(=O)(=O)C(F)(F)F)c1cccc(/C(C#N)=N/OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H4F6N4O6S2/c13-11(14,15)29(23,24)27-21-9(5-19)7-2-1-3-8(4-7)10(6-20)22-28-30(25,26)12(16,17)18/h1-4H/b21-9+,22-10+ |
| InChIKey | SWWMJCXWZYOXHD-VGENTYGXSA-N |
| XLogP | 1.87 |
| TPSA | 159.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|