C11H5F3N2O3S — CID 102505505
(2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate (PubChem CID 102505505) has the molecular formula C11H5F3N2O3S and a molecular weight of 302.23 g/mol. Its IUPAC name is (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate.
| Compound Name | (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102505505 |
| Molecular Formula | C11H5F3N2O3S |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate |
| SMILES | N#CC(C#N)=C(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H5F3N2O3S/c12-11(13,14)20(17,18)19-10(9(6-15)7-16)8-4-2-1-3-5-8/h1-5H |
| InChIKey | MZRJSOGJFBAYEB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|