(2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate

C11H5F3N2O3S — CID 102505505

IUPAC(2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate
SMILESN#CC(C#N)=C(OS(=O)(=O)C(F)(F)F)c1ccccc1
InChIInChI=1S/C11H5F3N2O3S/c12-11(13,14)20(17,18)19-10(9(6-15)7-16)8-4-2-1-3-5-8/h1-5H
InChIKeyMZRJSOGJFBAYEB-UHFFFAOYSA-N
MW302.23 g/mol
LogP2.31
Rot. Bonds3

About (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate

(2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate (PubChem CID 102505505) has the molecular formula C11H5F3N2O3S and a molecular weight of 302.23 g/mol. Its IUPAC name is (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate.

Molecular Properties

Compound Name(2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate
PubChem CID102505505
Molecular FormulaC11H5F3N2O3S
Molecular Weight302.23 g/mol
Exact Mass302.00
IUPAC Name(2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate
SMILESN#CC(C#N)=C(OS(=O)(=O)C(F)(F)F)c1ccccc1
InChIInChI=1S/C11H5F3N2O3S/c12-11(13,14)20(17,18)19-10(9(6-15)7-16)8-4-2-1-3-5-8/h1-5H
InChIKeyMZRJSOGJFBAYEB-UHFFFAOYSA-N
XLogP2.31
TPSA90.95 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.23
LogP ≤ 52.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate?
The IUPAC name of (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate (CID 102505505) is (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate.
What is the SMILES notation for (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate?
The canonical SMILES for (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate is N#CC(C#N)=C(OS(=O)(=O)C(F)(F)F)c1ccccc1.
What is the InChIKey of (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate?
The InChIKey is MZRJSOGJFBAYEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5F3N2O3S/c12-11(13,14)20(17,18)19-10(9(6-15)7-16)8-4-2-1-3-5-8/h1-5H.
What are the key properties of (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate?
(2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate has a molecular weight of 302.23 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dicyano-1-phenylethenyl) trifluoromethanesulfonate is sourced from PubChem (CID 102505505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).