C17H12F6N2O7S2 — CID 134883214
(E)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenediazonium;trifluoromethanesulfonate (PubChem CID 134883214) has the molecular formula C17H12F6N2O7S2 and a molecular weight of 534.41 g/mol. Its IUPAC name is (E)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenediazonium;trifluoromethanesulfonate.
| Compound Name | (E)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenediazonium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134883214 |
| Molecular Formula | C17H12F6N2O7S2 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | (E)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenediazonium;trifluoromethanesulfonate |
| SMILES | COc1ccc(/C(OS(=O)(=O)C(F)(F)F)=C(\[N+]#N)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H12F3N2O4S.CHF3O3S/c1-24-13-9-7-12(8-10-13)15(25-26(22,23)16(17,18)19)14(21-20)11-5-3-2-4-6-11;2-1(3,4)8(5,6)7/h2-10H,1H3;(H,5,6,7)/q+1;/p-1/b15-14+; |
| InChIKey | MWOASPKSGPZDGC-WPDLWGESSA-M |
| XLogP | 4.29 |
| TPSA | 137.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|