C26H21F3O6S — CID 44888171
2,6-bis(4-methoxyphenyl)-4-phenylpyrylium;trifluoromethanesulfonate (PubChem CID 44888171) has the molecular formula C26H21F3O6S and a molecular weight of 518.51 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-4-phenylpyrylium;trifluoromethanesulfonate.
| Compound Name | 2,6-bis(4-methoxyphenyl)-4-phenylpyrylium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888171 |
| Molecular Formula | C26H21F3O6S |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-4-phenylpyrylium;trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(OC)cc3)[o+]2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C25H21O3.CHF3O3S/c1-26-22-12-8-19(9-13-22)24-16-21(18-6-4-3-5-7-18)17-25(28-24)20-10-14-23(27-2)15-11-20;2-1(3,4)8(5,6)7/h3-17H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | HZFGOGIQVNASOC-UHFFFAOYSA-M |
| XLogP | 6.63 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|