C21H17F3O6S — CID 2737177
ethyl 4,6-diphenylpyrylium-2-carboxylate;trifluoromethanesulfonate (PubChem CID 2737177) has the molecular formula C21H17F3O6S and a molecular weight of 454.42 g/mol. Its IUPAC name is ethyl 4,6-diphenylpyrylium-2-carboxylate;trifluoromethanesulfonate.
| Compound Name | ethyl 4,6-diphenylpyrylium-2-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 2737177 |
| Molecular Formula | C21H17F3O6S |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | ethyl 4,6-diphenylpyrylium-2-carboxylate;trifluoromethanesulfonate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)cc(-c2ccccc2)[o+]1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H17O3.CHF3O3S/c1-2-22-20(21)19-14-17(15-9-5-3-6-10-15)13-18(23-19)16-11-7-4-8-12-16;2-1(3,4)8(5,6)7/h3-14H,2H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | PPKMWORCAQVUCI-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|