About 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium
2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium (PubChem CID 2841317) has the molecular formula C20H18O6S
and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium.
Molecular Properties
| Compound Name | 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium |
| PubChem CID | 2841317 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2ccccc2)[o+]1.O=C(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H15O.C2H4O5S/c1-14-12-17(15-8-4-2-5-9-15)13-18(19-14)16-10-6-3-7-11-16;3-2(4)1-8(5,6)7/h2-13H,1H3;1H2,(H,3,4)(H,5,6,7)/q+1;/p-1 |
| InChIKey | NRFQTHURPRUEBR-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium?
The IUPAC name of 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium (CID 2841317) is 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium.
What is the SMILES notation for 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium?
The canonical SMILES for 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium is Cc1cc(-c2ccccc2)cc(-c2ccccc2)[o+]1.O=C(O)CS(=O)(=O)[O-].
What is the InChIKey of 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium?
The InChIKey is NRFQTHURPRUEBR-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15O.C2H4O5S/c1-14-12-17(15-8-4-2-5-9-15)13-18(19-14)16-10-6-3-7-11-16;3-2(4)1-8(5,6)7/h2-13H,1H3;1H2,(H,3,4)(H,5,6,7)/q+1;/p-1.
What are the key properties of 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium?
2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium has a molecular weight of 386.43 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-oxoethanesulfonate;2-methyl-4,6-diphenylpyrylium is sourced from PubChem (CID 2841317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).