C21H14O4S2 — CID 3722061
5-(2,6-diphenylpyrylium-4-yl)thiophene-2-sulfonate (PubChem CID 3722061) has the molecular formula C21H14O4S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 5-(2,6-diphenylpyrylium-4-yl)thiophene-2-sulfonate.
| Compound Name | 5-(2,6-diphenylpyrylium-4-yl)thiophene-2-sulfonate |
|---|---|
| PubChem CID | 3722061 |
| Molecular Formula | C21H14O4S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 5-(2,6-diphenylpyrylium-4-yl)thiophene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)s1 |
| InChI | InChI=1S/C21H14O4S2/c22-27(23,24)21-12-11-20(26-21)17-13-18(15-7-3-1-4-8-15)25-19(14-17)16-9-5-2-6-10-16/h1-14H |
| InChIKey | IGXMXTYVHYJESI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|