C40H28S — CID 175285531
2,5-bis(3,5-diphenylphenyl)thiophene (PubChem CID 175285531) has the molecular formula C40H28S and a molecular weight of 540.73 g/mol. Its IUPAC name is 2,5-bis(3,5-diphenylphenyl)thiophene.
| Compound Name | 2,5-bis(3,5-diphenylphenyl)thiophene |
|---|---|
| PubChem CID | 175285531 |
| Molecular Formula | C40H28S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 2,5-bis(3,5-diphenylphenyl)thiophene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)s3)c2)cc1 |
| InChI | InChI=1S/C40H28S/c1-5-13-29(14-6-1)33-23-34(30-15-7-2-8-16-30)26-37(25-33)39-21-22-40(41-39)38-27-35(31-17-9-3-10-18-31)24-36(28-38)32-19-11-4-12-20-32/h1-28H |
| InChIKey | XANKSPBFSMFNAY-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |