C32H21BrS2 — CID 139982056
2-bromo-5-[5-[4-[4-(4-phenylphenyl)phenyl]phenyl]thiophen-2-yl]thiophene (PubChem CID 139982056) has the molecular formula C32H21BrS2 and a molecular weight of 549.56 g/mol. Its IUPAC name is 2-bromo-5-[5-[4-[4-(4-phenylphenyl)phenyl]phenyl]thiophen-2-yl]thiophene.
| Compound Name | 2-bromo-5-[5-[4-[4-(4-phenylphenyl)phenyl]phenyl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 139982056 |
| Molecular Formula | C32H21BrS2 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | 2-bromo-5-[5-[4-[4-(4-phenylphenyl)phenyl]phenyl]thiophen-2-yl]thiophene |
| SMILES | Brc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccccc6)cc5)cc4)cc3)s2)s1 |
| InChI | InChI=1S/C32H21BrS2/c33-32-21-20-31(35-32)30-19-18-29(34-30)28-16-14-27(15-17-28)26-12-10-25(11-13-26)24-8-6-23(7-9-24)22-4-2-1-3-5-22/h1-21H |
| InChIKey | OJVMZINYYHYRGF-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |