C36H24S3 — CID 11734344
2-[3,5-bis(5-phenylthiophen-2-yl)phenyl]-5-phenylthiophene (PubChem CID 11734344) has the molecular formula C36H24S3 and a molecular weight of 552.79 g/mol. Its IUPAC name is 2-[3,5-bis(5-phenylthiophen-2-yl)phenyl]-5-phenylthiophene.
| Compound Name | 2-[3,5-bis(5-phenylthiophen-2-yl)phenyl]-5-phenylthiophene |
|---|---|
| PubChem CID | 11734344 |
| Molecular Formula | C36H24S3 |
| Molecular Weight | 552.79 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 2-[3,5-bis(5-phenylthiophen-2-yl)phenyl]-5-phenylthiophene |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)s4)cc(-c4ccc(-c5ccccc5)s4)c3)s2)cc1 |
| InChI | InChI=1S/C36H24S3/c1-4-10-25(11-5-1)31-16-19-34(37-31)28-22-29(35-20-17-32(38-35)26-12-6-2-7-13-26)24-30(23-28)36-21-18-33(39-36)27-14-8-3-9-15-27/h1-24H |
| InChIKey | GDHKUYBZRNPXQJ-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.79 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |