C20H14OS — CID 91337599
3-phenyl-4-(5-phenylthiophen-2-yl)furan (PubChem CID 91337599) has the molecular formula C20H14OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-phenyl-4-(5-phenylthiophen-2-yl)furan.
| Compound Name | 3-phenyl-4-(5-phenylthiophen-2-yl)furan |
|---|---|
| PubChem CID | 91337599 |
| Molecular Formula | C20H14OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-phenyl-4-(5-phenylthiophen-2-yl)furan |
| SMILES | c1ccc(-c2ccc(-c3cocc3-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C20H14OS/c1-3-7-15(8-4-1)17-13-21-14-18(17)20-12-11-19(22-20)16-9-5-2-6-10-16/h1-14H |
| InChIKey | XGHCPXOWQLDSDM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |