C36H22F4S4 — CID 155884668
2-methyl-5-(5-phenylthiophen-2-yl)-3-[2,3,4,5-tetrafluoro-6-[2-methyl-5-(5-phenylthiophen-2-yl)thiophen-3-yl]phenyl]thiophene (PubChem CID 155884668) has the molecular formula C36H22F4S4 and a molecular weight of 658.83 g/mol. Its IUPAC name is 2-methyl-5-(5-phenylthiophen-2-yl)-3-[2,3,4,5-tetrafluoro-6-[2-methyl-5-(5-phenylthiophen-2-yl)thiophen-3-yl]phenyl]thiophene.
| Compound Name | 2-methyl-5-(5-phenylthiophen-2-yl)-3-[2,3,4,5-tetrafluoro-6-[2-methyl-5-(5-phenylthiophen-2-yl)thiophen-3-yl]phenyl]thiophene |
|---|---|
| PubChem CID | 155884668 |
| Molecular Formula | C36H22F4S4 |
| Molecular Weight | 658.83 g/mol |
| Exact Mass | 658.05 |
| IUPAC Name | 2-methyl-5-(5-phenylthiophen-2-yl)-3-[2,3,4,5-tetrafluoro-6-[2-methyl-5-(5-phenylthiophen-2-yl)thiophen-3-yl]phenyl]thiophene |
| SMILES | Cc1sc(-c2ccc(-c3ccccc3)s2)cc1-c1c(F)c(F)c(F)c(F)c1-c1cc(-c2ccc(-c3ccccc3)s2)sc1C |
| InChI | InChI=1S/C36H22F4S4/c1-19-23(17-29(41-19)27-15-13-25(43-27)21-9-5-3-6-10-21)31-32(34(38)36(40)35(39)33(31)37)24-18-30(42-20(24)2)28-16-14-26(44-28)22-11-7-4-8-12-22/h3-18H,1-2H3 |
| InChIKey | AMDUTTGVPPCXJN-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.83 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|