About CID 20746426
CID 20746426 (PubChem CID 20746426) has the molecular formula C32H23BF5S
and a molecular weight of 545.41 g/mol.
Molecular Properties
| Compound Name | CID 20746426 |
| PubChem CID | 20746426 |
| Molecular Formula | C32H23BF5S |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | — |
| SMILES | Cc1c(C)c(-c2ccc(-c3c(F)c(F)c(F)c(F)c3F)s2)c(C)c(C)c1[B]c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H23BF5S/c1-16-18(3)27(33-22-12-10-21(11-13-22)20-8-6-5-7-9-20)19(4)17(2)25(16)23-14-15-24(39-23)26-28(34)30(36)32(38)31(37)29(26)35/h5-15H,1-4H3 |
| InChIKey | ROYVFGJUVGLKNG-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20746426 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20746426?
The IUPAC name of CID 20746426 (CID 20746426) is not available.
What is the SMILES notation for CID 20746426?
The canonical SMILES for CID 20746426 is Cc1c(C)c(-c2ccc(-c3c(F)c(F)c(F)c(F)c3F)s2)c(C)c(C)c1[B]c1ccc(-c2ccccc2)cc1.
What is the InChIKey of CID 20746426?
The InChIKey is ROYVFGJUVGLKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H23BF5S/c1-16-18(3)27(33-22-12-10-21(11-13-22)20-8-6-5-7-9-20)19(4)17(2)25(16)23-14-15-24(39-23)26-28(34)30(36)32(38)31(37)29(26)35/h5-15H,1-4H3.
What are the key properties of CID 20746426?
CID 20746426 has a molecular weight of 545.41 g/mol, XLogP of 8.33, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20746426 is sourced from PubChem (CID 20746426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).