C32H22O2S2 — CID 101124465
2,3-bis(2-methyl-5-phenylthiophen-3-yl)naphthalene-1,4-dione (PubChem CID 101124465) has the molecular formula C32H22O2S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 2,3-bis(2-methyl-5-phenylthiophen-3-yl)naphthalene-1,4-dione.
| Compound Name | 2,3-bis(2-methyl-5-phenylthiophen-3-yl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 101124465 |
| Molecular Formula | C32H22O2S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 2,3-bis(2-methyl-5-phenylthiophen-3-yl)naphthalene-1,4-dione |
| SMILES | Cc1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccccc3)sc2C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H22O2S2/c1-19-25(17-27(35-19)21-11-5-3-6-12-21)29-30(32(34)24-16-10-9-15-23(24)31(29)33)26-18-28(36-20(26)2)22-13-7-4-8-14-22/h3-18H,1-2H3 |
| InChIKey | QIRQHWRFROTGEI-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|