C28H18O2S4 — CID 101124466
2,3-bis(2-methyl-5-thiophen-2-ylthiophen-3-yl)naphthalene-1,4-dione (PubChem CID 101124466) has the molecular formula C28H18O2S4 and a molecular weight of 514.72 g/mol. Its IUPAC name is 2,3-bis(2-methyl-5-thiophen-2-ylthiophen-3-yl)naphthalene-1,4-dione.
| Compound Name | 2,3-bis(2-methyl-5-thiophen-2-ylthiophen-3-yl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 101124466 |
| Molecular Formula | C28H18O2S4 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 2,3-bis(2-methyl-5-thiophen-2-ylthiophen-3-yl)naphthalene-1,4-dione |
| SMILES | Cc1sc(-c2cccs2)cc1C1=C(c2cc(-c3cccs3)sc2C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H18O2S4/c1-15-19(13-23(33-15)21-9-5-11-31-21)25-26(28(30)18-8-4-3-7-17(18)27(25)29)20-14-24(34-16(20)2)22-10-6-12-32-22/h3-14H,1-2H3 |
| InChIKey | POXBGHLMQQNHNQ-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|