C22H12O2S2 — CID 11079243
2,6-dithiophen-2-ylanthracene-9,10-dione (PubChem CID 11079243) has the molecular formula C22H12O2S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2,6-dithiophen-2-ylanthracene-9,10-dione.
| Compound Name | 2,6-dithiophen-2-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 11079243 |
| Molecular Formula | C22H12O2S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2,6-dithiophen-2-ylanthracene-9,10-dione |
| SMILES | O=C1c2ccc(-c3cccs3)cc2C(=O)c2ccc(-c3cccs3)cc21 |
| InChI | InChI=1S/C22H12O2S2/c23-21-16-8-6-14(20-4-2-10-26-20)12-18(16)22(24)15-7-5-13(11-17(15)21)19-3-1-9-25-19/h1-12H |
| InChIKey | LSRBPUYOBJYXTD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|