C15H13BrOS2 — CID 71484785
5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-thiophen-2-ylcyclopent-2-en-1-one (PubChem CID 71484785) has the molecular formula C15H13BrOS2 and a molecular weight of 353.31 g/mol. Its IUPAC name is 5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-thiophen-2-ylcyclopent-2-en-1-one.
| Compound Name | 5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-thiophen-2-ylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 71484785 |
| Molecular Formula | C15H13BrOS2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-thiophen-2-ylcyclopent-2-en-1-one |
| SMILES | Cc1cc(C2=C(c3cccs3)CC(Br)C2=O)c(C)s1 |
| InChI | InChI=1S/C15H13BrOS2/c1-8-6-10(9(2)19-8)14-11(7-12(16)15(14)17)13-4-3-5-18-13/h3-6,12H,7H2,1-2H3 |
| InChIKey | UWHSTXGJSLJYKZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|