C12H8O2S2 — CID 2398030
3,4-dithiophen-2-yl-2H-furan-5-one (PubChem CID 2398030) has the molecular formula C12H8O2S2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3,4-dithiophen-2-yl-2H-furan-5-one.
| Compound Name | 3,4-dithiophen-2-yl-2H-furan-5-one |
|---|---|
| PubChem CID | 2398030 |
| Molecular Formula | C12H8O2S2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 3,4-dithiophen-2-yl-2H-furan-5-one |
| SMILES | O=C1OCC(c2cccs2)=C1c1cccs1 |
| InChI | InChI=1S/C12H8O2S2/c13-12-11(10-4-2-6-16-10)8(7-14-12)9-3-1-5-15-9/h1-6H,7H2 |
| InChIKey | KFXQIVGZTSPGKX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |