C21H17BrOS — CID 71484654
5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-naphthalen-1-ylcyclopent-2-en-1-one (PubChem CID 71484654) has the molecular formula C21H17BrOS and a molecular weight of 397.34 g/mol. Its IUPAC name is 5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-naphthalen-1-ylcyclopent-2-en-1-one.
| Compound Name | 5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-naphthalen-1-ylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 71484654 |
| Molecular Formula | C21H17BrOS |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 5-bromo-2-(2,5-dimethylthiophen-3-yl)-3-naphthalen-1-ylcyclopent-2-en-1-one |
| SMILES | Cc1cc(C2=C(c3cccc4ccccc34)CC(Br)C2=O)c(C)s1 |
| InChI | InChI=1S/C21H17BrOS/c1-12-10-17(13(2)24-12)20-18(11-19(22)21(20)23)16-9-5-7-14-6-3-4-8-15(14)16/h3-10,19H,11H2,1-2H3 |
| InChIKey | JSOLEEYBSWXQIB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|