C22H14S4 — CID 126765639
4,11-dimethyl-7,14-dithiophen-2-yl-5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(14),2(6),3,7,9(13),10-hexaene (PubChem CID 126765639) has the molecular formula C22H14S4 and a molecular weight of 406.62 g/mol. Its IUPAC name is 4,11-dimethyl-7,14-dithiophen-2-yl-5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(14),2(6),3,7,9(13),10-hexaene.
| Compound Name | 4,11-dimethyl-7,14-dithiophen-2-yl-5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(14),2(6),3,7,9(13),10-hexaene |
|---|---|
| PubChem CID | 126765639 |
| Molecular Formula | C22H14S4 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 4,11-dimethyl-7,14-dithiophen-2-yl-5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(14),2(6),3,7,9(13),10-hexaene |
| SMILES | Cc1cc2c(s1)C(c1cccs1)=C1C2=C(c2cccs2)c2sc(C)cc21 |
| InChI | InChI=1S/C22H14S4/c1-11-9-13-17-18(19(21(13)25-11)15-5-3-7-23-15)14-10-12(2)26-22(14)20(17)16-6-4-8-24-16/h3-10H,1-2H3 |
| InChIKey | UUDDNEOIQPONTF-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |