C47H37BO — CID 139713157
tetraphenylboranuide;2,4,6-triphenylpyrylium (PubChem CID 139713157) has the molecular formula C47H37BO and a molecular weight of 628.62 g/mol. Its IUPAC name is tetraphenylboranuide;2,4,6-triphenylpyrylium.
| Compound Name | tetraphenylboranuide;2,4,6-triphenylpyrylium |
|---|---|
| PubChem CID | 139713157 |
| Molecular Formula | C47H37BO |
| Molecular Weight | 628.62 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | tetraphenylboranuide;2,4,6-triphenylpyrylium |
| SMILES | c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C23H17O/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20/h1-20H;1-17H/q-1;+1 |
| InChIKey | WNJRBNLYCYTEQJ-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.62 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|