C22H16ClNO5 — CID 44887999
2-(4,6-diphenylpyrylium-2-yl)pyridine perchlorate (PubChem CID 44887999) has the molecular formula C22H16ClNO5 and a molecular weight of 409.83 g/mol. Its IUPAC name is 2-(4,6-diphenylpyrylium-2-yl)pyridine perchlorate.
| Compound Name | 2-(4,6-diphenylpyrylium-2-yl)pyridine perchlorate |
|---|---|
| PubChem CID | 44887999 |
| Molecular Formula | C22H16ClNO5 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-(4,6-diphenylpyrylium-2-yl)pyridine perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C22H16NO.ClHO4/c1-3-9-17(10-4-1)19-15-21(18-11-5-2-6-12-18)24-22(16-19)20-13-7-8-14-23-20;2-1(3,4)5/h1-16H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LOJNBLCUJIAPDV-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 116.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|