C24H16ClNO5S — CID 12694167
2-(4,6-diphenylpyrylium-2-yl)-1,3-benzothiazole perchlorate (PubChem CID 12694167) has the molecular formula C24H16ClNO5S and a molecular weight of 465.91 g/mol. Its IUPAC name is 2-(4,6-diphenylpyrylium-2-yl)-1,3-benzothiazole perchlorate.
| Compound Name | 2-(4,6-diphenylpyrylium-2-yl)-1,3-benzothiazole perchlorate |
|---|---|
| PubChem CID | 12694167 |
| Molecular Formula | C24H16ClNO5S |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 2-(4,6-diphenylpyrylium-2-yl)-1,3-benzothiazole perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C24H16NOS.ClHO4/c1-3-9-17(10-4-1)19-15-21(18-11-5-2-6-12-18)26-22(16-19)24-25-20-13-7-8-14-23(20)27-24;2-1(3,4)5/h1-16H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | FXIVBPWCDWFUOU-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 116.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|