C29H27ClN2O4S — CID 44888311
2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole perchlorate (PubChem CID 44888311) has the molecular formula C29H27ClN2O4S and a molecular weight of 535.07 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole perchlorate.
| Compound Name | 2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole perchlorate |
|---|---|
| PubChem CID | 44888311 |
| Molecular Formula | C29H27ClN2O4S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole perchlorate |
| SMILES | CC(C)(C)C[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1nc2ccccc2s1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H27N2S.ClHO4/c1-29(2,3)20-31-25(22-14-8-5-9-15-22)18-23(21-12-6-4-7-13-21)19-26(31)28-30-24-16-10-11-17-27(24)32-28;2-1(3,4)5/h4-19H,20H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KFKXWCWNUAVXME-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|