C32H20N4S — CID 134237425
2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3-benzothiazole (PubChem CID 134237425) has the molecular formula C32H20N4S and a molecular weight of 492.61 g/mol. Its IUPAC name is 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 134237425 |
| Molecular Formula | C32H20N4S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4cc(-c5nc6ccccc6s5)ccc4c3)n2)cc1 |
| InChI | InChI=1S/C32H20N4S/c1-3-9-21(10-4-1)29-34-30(22-11-5-2-6-12-22)36-31(35-29)25-17-15-24-20-26(18-16-23(24)19-25)32-33-27-13-7-8-14-28(27)37-32/h1-20H |
| InChIKey | HBEXJZKNUYBKKP-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |