C29H27N2S+ — CID 3406108
2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole (PubChem CID 3406108) has the molecular formula C29H27N2S+ and a molecular weight of 435.62 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3406108 |
| Molecular Formula | C29H27N2S+ |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[1-(2,2-dimethylpropyl)-4,6-diphenylpyridin-1-ium-2-yl]-1,3-benzothiazole |
| SMILES | CC(C)(C)C[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H27N2S/c1-29(2,3)20-31-25(22-14-8-5-9-15-22)18-23(21-12-6-4-7-13-21)19-26(31)28-30-24-16-10-11-17-27(24)32-28/h4-19H,20H2,1-3H3/q+1 |
| InChIKey | CNLBASALTARHPO-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|