C39H20F5NS — CID 166850313
2-[4-[6-[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]naphthalen-2-yl]phenyl]-1,3-benzothiazole (PubChem CID 166850313) has the molecular formula C39H20F5NS and a molecular weight of 629.65 g/mol. Its IUPAC name is 2-[4-[6-[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]naphthalen-2-yl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-[6-[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]naphthalen-2-yl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 166850313 |
| Molecular Formula | C39H20F5NS |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 629.12 |
| IUPAC Name | 2-[4-[6-[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]naphthalen-2-yl]phenyl]-1,3-benzothiazole |
| SMILES | Fc1c(F)c(F)c(-c2ccc3cc(-c4ccc5cc(-c6ccc(-c7nc8ccccc8s7)cc6)ccc5c4)ccc3c2)c(F)c1F |
| InChI | InChI=1S/C39H20F5NS/c40-34-33(35(41)37(43)38(44)36(34)42)30-16-15-28-19-27(13-14-29(28)20-30)26-12-11-24-17-23(9-10-25(24)18-26)21-5-7-22(8-6-21)39-45-31-3-1-2-4-32(31)46-39/h1-20H |
| InChIKey | NXULLZXLNSYUMT-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|