C13H5F4NOS — CID 136865282
2-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrafluorophenol (PubChem CID 136865282) has the molecular formula C13H5F4NOS and a molecular weight of 299.25 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrafluorophenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrafluorophenol |
|---|---|
| PubChem CID | 136865282 |
| Molecular Formula | C13H5F4NOS |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrafluorophenol |
| SMILES | Oc1c(F)c(F)c(F)c(F)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H5F4NOS/c14-8-7(12(19)11(17)10(16)9(8)15)13-18-5-3-1-2-4-6(5)20-13/h1-4,19H |
| InChIKey | YYGJOFWAYZCUKR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|