C14H5Cl4NO2S — CID 137273564
2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrachloro-3-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 137273564) has the molecular formula C14H5Cl4NO2S and a molecular weight of 393.08 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrachloro-3-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrachloro-3-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 137273564 |
| Molecular Formula | C14H5Cl4NO2S |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.88 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrachloro-3-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1c(Cl)c(Cl)c(Cl)c(Cl)c(O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H5Cl4NO2S/c15-8-9(16)11(18)13(21)7(12(20)10(8)17)14-19-5-3-1-2-4-6(5)22-14/h1-4,20H |
| InChIKey | WAOVVGMHPYBELF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |