C14H4Cl5NO2S — CID 137273565
2,3,4,5-tetrachloro-7-(5-chloro-1,3-benzothiazol-2-yl)-6-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 137273565) has the molecular formula C14H4Cl5NO2S and a molecular weight of 427.52 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-7-(5-chloro-1,3-benzothiazol-2-yl)-6-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,3,4,5-tetrachloro-7-(5-chloro-1,3-benzothiazol-2-yl)-6-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 137273565 |
| Molecular Formula | C14H4Cl5NO2S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 424.84 |
| IUPAC Name | 2,3,4,5-tetrachloro-7-(5-chloro-1,3-benzothiazol-2-yl)-6-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1c(Cl)c(Cl)c(Cl)c(Cl)c(O)c1-c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C14H4Cl5NO2S/c15-4-1-2-6-5(3-4)20-14(23-6)7-12(21)10(18)8(16)9(17)11(19)13(7)22/h1-3,21H |
| InChIKey | LOAUSYGROPBINW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |