C23H18N2O2SZn — CID 161102870
3-(1,3-benzothiazol-2-yl)-4-hydroxy-1-phenylquinolin-2-one;methane;zinc (PubChem CID 161102870) has the molecular formula C23H18N2O2SZn and a molecular weight of 451.87 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-hydroxy-1-phenylquinolin-2-one;methane;zinc.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-hydroxy-1-phenylquinolin-2-one;methane;zinc |
|---|---|
| PubChem CID | 161102870 |
| Molecular Formula | C23H18N2O2SZn |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-hydroxy-1-phenylquinolin-2-one;methane;zinc |
| SMILES | C.O=c1c(-c2nc3ccccc3s2)c(O)c2ccccc2n1-c1ccccc1.[Zn] |
| InChI | InChI=1S/C22H14N2O2S.CH4.Zn/c25-20-15-10-4-6-12-17(15)24(14-8-2-1-3-9-14)22(26)19(20)21-23-16-11-5-7-13-18(16)27-21;;/h1-13,25H;1H4; |
| InChIKey | NDNSWJJQWANQIY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|