C18H12N2O3 — CID 135449722
4-hydroxy-3-(1,2-oxazol-3-yl)-1-phenylquinolin-2-one (PubChem CID 135449722) has the molecular formula C18H12N2O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 4-hydroxy-3-(1,2-oxazol-3-yl)-1-phenylquinolin-2-one.
| Compound Name | 4-hydroxy-3-(1,2-oxazol-3-yl)-1-phenylquinolin-2-one |
|---|---|
| PubChem CID | 135449722 |
| Molecular Formula | C18H12N2O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-hydroxy-3-(1,2-oxazol-3-yl)-1-phenylquinolin-2-one |
| SMILES | O=c1c(-c2ccon2)c(O)c2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C18H12N2O3/c21-17-13-8-4-5-9-15(13)20(12-6-2-1-3-7-12)18(22)16(17)14-10-11-23-19-14/h1-11,21H |
| InChIKey | IYTKGCFYMLDLBO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |