C35H30N2O4 — CID 110273136
4-hydroxy-3-[5-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)pentyl]-1-phenylquinolin-2-one (PubChem CID 110273136) has the molecular formula C35H30N2O4 and a molecular weight of 542.64 g/mol. Its IUPAC name is 4-hydroxy-3-[5-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)pentyl]-1-phenylquinolin-2-one.
| Compound Name | 4-hydroxy-3-[5-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)pentyl]-1-phenylquinolin-2-one |
|---|---|
| PubChem CID | 110273136 |
| Molecular Formula | C35H30N2O4 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 4-hydroxy-3-[5-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)pentyl]-1-phenylquinolin-2-one |
| SMILES | O=c1c(CCCCCc2c(O)c3ccccc3n(-c3ccccc3)c2=O)c(O)c2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C35H30N2O4/c38-32-26-18-10-12-22-30(26)36(24-14-4-1-5-15-24)34(40)28(32)20-8-3-9-21-29-33(39)27-19-11-13-23-31(27)37(35(29)41)25-16-6-2-7-17-25/h1-2,4-7,10-19,22-23,38-39H,3,8-9,20-21H2 |
| InChIKey | YLWMCHPBSXXHEL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|