C16H11N3OS — CID 11748385
2-amino-3-(1,3-benzothiazol-2-yl)-1H-quinolin-4-one (PubChem CID 11748385) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-amino-3-(1,3-benzothiazol-2-yl)-1H-quinolin-4-one.
| Compound Name | 2-amino-3-(1,3-benzothiazol-2-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 11748385 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-amino-3-(1,3-benzothiazol-2-yl)-1H-quinolin-4-one |
| SMILES | Nc1[nH]c2ccccc2c(=O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H11N3OS/c17-15-13(14(20)9-5-1-2-6-10(9)18-15)16-19-11-7-3-4-8-12(11)21-16/h1-8H,(H3,17,18,20) |
| InChIKey | HVTRERSYKUDBOU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |