C21H12N2O5S3 — CID 163533245
1-amino-4-(1,3-benzothiazol-2-yl)-9,10-dioxo-3-sulfanylanthracene-2-sulfonic acid (PubChem CID 163533245) has the molecular formula C21H12N2O5S3 and a molecular weight of 468.54 g/mol. Its IUPAC name is 1-amino-4-(1,3-benzothiazol-2-yl)-9,10-dioxo-3-sulfanylanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-(1,3-benzothiazol-2-yl)-9,10-dioxo-3-sulfanylanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 163533245 |
| Molecular Formula | C21H12N2O5S3 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 1-amino-4-(1,3-benzothiazol-2-yl)-9,10-dioxo-3-sulfanylanthracene-2-sulfonic acid |
| SMILES | Nc1c2c(c(-c3nc4ccccc4s3)c(S)c1S(=O)(=O)O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H12N2O5S3/c22-16-14-13(17(24)9-5-1-2-6-10(9)18(14)25)15(19(29)20(16)31(26,27)28)21-23-11-7-3-4-8-12(11)30-21/h1-8,29H,22H2,(H,26,27,28) |
| InChIKey | GCRFFGDYYCHZCH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|