C20H15N3O5S — CID 154090052
1,3-diamino-4-(3-aminophenyl)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 154090052) has the molecular formula C20H15N3O5S and a molecular weight of 409.42 g/mol. Its IUPAC name is 1,3-diamino-4-(3-aminophenyl)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1,3-diamino-4-(3-aminophenyl)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 154090052 |
| Molecular Formula | C20H15N3O5S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 1,3-diamino-4-(3-aminophenyl)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1cccc(-c2c(N)c(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C20H15N3O5S/c21-10-5-3-4-9(8-10)13-14-15(17(23)20(16(13)22)29(26,27)28)19(25)12-7-2-1-6-11(12)18(14)24/h1-8H,21-23H2,(H,26,27,28) |
| InChIKey | BZCNWXSQIRXLLU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 166.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|