C22H19N3O5S — CID 157471976
1,3-diamino-4-[3-(ethylamino)phenyl]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 157471976) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 1,3-diamino-4-[3-(ethylamino)phenyl]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1,3-diamino-4-[3-(ethylamino)phenyl]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 157471976 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 1,3-diamino-4-[3-(ethylamino)phenyl]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | CCNc1cccc(-c2c(N)c(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C22H19N3O5S/c1-2-25-12-7-5-6-11(10-12)15-16-17(19(24)22(18(15)23)31(28,29)30)21(27)14-9-4-3-8-13(14)20(16)26/h3-10,25H,2,23-24H2,1H3,(H,28,29,30) |
| InChIKey | VWIYWXUVSMZXFN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|