C24H20N2O — CID 139931818
3-[2,3-bis(3-aminophenyl)phenyl]phenol (PubChem CID 139931818) has the molecular formula C24H20N2O and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-[2,3-bis(3-aminophenyl)phenyl]phenol.
| Compound Name | 3-[2,3-bis(3-aminophenyl)phenyl]phenol |
|---|---|
| PubChem CID | 139931818 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[2,3-bis(3-aminophenyl)phenyl]phenol |
| SMILES | Nc1cccc(-c2cccc(-c3cccc(O)c3)c2-c2cccc(N)c2)c1 |
| InChI | InChI=1S/C24H20N2O/c25-19-8-1-5-16(13-19)22-11-4-12-23(17-6-3-10-21(27)15-17)24(22)18-7-2-9-20(26)14-18/h1-15,27H,25-26H2 |
| InChIKey | KKVSINGUHBVXAH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|