C24H24N6 — CID 67410008
5-[2,3-bis(3,5-diaminophenyl)phenyl]benzene-1,3-diamine (PubChem CID 67410008) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 5-[2,3-bis(3,5-diaminophenyl)phenyl]benzene-1,3-diamine.
| Compound Name | 5-[2,3-bis(3,5-diaminophenyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 67410008 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 5-[2,3-bis(3,5-diaminophenyl)phenyl]benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(-c2cccc(-c3cc(N)cc(N)c3)c2-c2cc(N)cc(N)c2)c1 |
| InChI | InChI=1S/C24H24N6/c25-16-4-13(5-17(26)10-16)22-2-1-3-23(14-6-18(27)11-19(28)7-14)24(22)15-8-20(29)12-21(30)9-15/h1-12H,25-30H2 |
| InChIKey | CLMCBAHAKWATHO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|