About tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine
tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine (PubChem CID 172543836) has the molecular formula C10H7N
and a molecular weight of 141.17 g/mol. Its IUPAC name is tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine.
Analyze tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine?
The IUPAC name of tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine (CID 172543836) is tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine.
What is the SMILES notation for tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine?
The canonical SMILES for tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine is Nc1cc2c3cccc-3c-2c1.
What is the InChIKey of tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine?
The InChIKey is XDQPXWAJLYOOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N/c11-6-4-9-7-2-1-3-8(7)10(9)5-6/h1-5H,11H2.
What are the key properties of tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine?
tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine has a molecular weight of 141.17 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaen-4-amine is sourced from PubChem (CID 172543836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).