C14H9NO6S — CID 154119724
3-amino-2-hydroxy-9,10-dioxoanthracene-1-sulfonic acid (PubChem CID 154119724) has the molecular formula C14H9NO6S and a molecular weight of 319.29 g/mol. Its IUPAC name is 3-amino-2-hydroxy-9,10-dioxoanthracene-1-sulfonic acid.
| Compound Name | 3-amino-2-hydroxy-9,10-dioxoanthracene-1-sulfonic acid |
|---|---|
| PubChem CID | 154119724 |
| Molecular Formula | C14H9NO6S |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 3-amino-2-hydroxy-9,10-dioxoanthracene-1-sulfonic acid |
| SMILES | Nc1cc2c(c(S(=O)(=O)O)c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO6S/c15-9-5-8-10(14(13(9)18)22(19,20)21)12(17)7-4-2-1-3-6(7)11(8)16/h1-5,18H,15H2,(H,19,20,21) |
| InChIKey | WYXGKUFRZZEUAC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|