C14H7N3O5S — CID 57356262
5,10-dioxo-2H-naphtho[2,3-f]benzotriazole-4-sulfonic acid (PubChem CID 57356262) has the molecular formula C14H7N3O5S and a molecular weight of 329.29 g/mol. Its IUPAC name is 5,10-dioxo-2H-naphtho[2,3-f]benzotriazole-4-sulfonic acid.
| Compound Name | 5,10-dioxo-2H-naphtho[2,3-f]benzotriazole-4-sulfonic acid |
|---|---|
| PubChem CID | 57356262 |
| Molecular Formula | C14H7N3O5S |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 5,10-dioxo-2H-naphtho[2,3-f]benzotriazole-4-sulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc1n[nH]nc1c2S(=O)(=O)O |
| InChI | InChI=1S/C14H7N3O5S/c18-12-6-3-1-2-4-7(6)13(19)10-8(12)5-9-11(16-17-15-9)14(10)23(20,21)22/h1-5H,(H,15,16,17)(H,20,21,22) |
| InChIKey | BMCWFJFKTNSKOE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|