C14H9LiO5S — CID 174968408
lithium;9,10-dioxoanthracene-1-sulfonic acid;hydride (PubChem CID 174968408) has the molecular formula C14H9LiO5S and a molecular weight of 296.23 g/mol. Its IUPAC name is lithium;9,10-dioxoanthracene-1-sulfonic acid;hydride.
| Compound Name | lithium;9,10-dioxoanthracene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 174968408 |
| Molecular Formula | C14H9LiO5S |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | lithium;9,10-dioxoanthracene-1-sulfonic acid;hydride |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2S(=O)(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C14H8O5S.Li.H/c15-13-8-4-1-2-5-9(8)14(16)12-10(13)6-3-7-11(12)20(17,18)19;;/h1-7H,(H,17,18,19);;/q;+1;-1 |
| InChIKey | UJICZKJUSAEDLF-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|