C15H10O5S — CID 89441677
5-methyl-9,10-dioxoanthracene-1-sulfonic acid (PubChem CID 89441677) has the molecular formula C15H10O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is 5-methyl-9,10-dioxoanthracene-1-sulfonic acid.
| Compound Name | 5-methyl-9,10-dioxoanthracene-1-sulfonic acid |
|---|---|
| PubChem CID | 89441677 |
| Molecular Formula | C15H10O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 5-methyl-9,10-dioxoanthracene-1-sulfonic acid |
| SMILES | Cc1cccc2c1C(=O)c1cccc(S(=O)(=O)O)c1C2=O |
| InChI | InChI=1S/C15H10O5S/c1-8-4-2-5-9-12(8)14(16)10-6-3-7-11(21(18,19)20)13(10)15(9)17/h2-7H,1H3,(H,18,19,20) |
| InChIKey | PWZSJOGWSFKMFR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|