C29H18O4 — CID 158636797
anthracene-9,10-dione;1-methylanthracene-9,10-dione (PubChem CID 158636797) has the molecular formula C29H18O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is anthracene-9,10-dione;1-methylanthracene-9,10-dione.
| Compound Name | anthracene-9,10-dione;1-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 158636797 |
| Molecular Formula | C29H18O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | anthracene-9,10-dione;1-methylanthracene-9,10-dione |
| SMILES | Cc1cccc2c1C(=O)c1ccccc1C2=O.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H10O2.C14H8O2/c1-9-5-4-8-12-13(9)15(17)11-7-3-2-6-10(11)14(12)16;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h2-8H,1H3;1-8H |
| InChIKey | HZWHNYMIXJSXNG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|